C23H30N2O5 — CID 23291576
cyclohexanamine;N-(4-formylphenyl)acetamide;4-methoxybenzoic acid (PubChem CID 23291576) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is cyclohexanamine;N-(4-formylphenyl)acetamide;4-methoxybenzoic acid.
| Compound Name | cyclohexanamine;N-(4-formylphenyl)acetamide;4-methoxybenzoic acid |
|---|---|
| PubChem CID | 23291576 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | cyclohexanamine;N-(4-formylphenyl)acetamide;4-methoxybenzoic acid |
| SMILES | CC(=O)Nc1ccc(C=O)cc1.COc1ccc(C(=O)O)cc1.NC1CCCCC1 |
| InChI | InChI=1S/C9H9NO2.C8H8O3.C6H13N/c1-7(12)10-9-4-2-8(6-11)3-5-9;1-11-7-4-2-6(3-5-7)8(9)10;7-6-4-2-1-3-5-6/h2-6H,1H3,(H,10,12);2-5H,1H3,(H,9,10);6H,1-5,7H2 |
| InChIKey | AUPIFKBFPJZMLV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|