About 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde
2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde (PubChem CID 23291880) has the molecular formula C16H23F3N2O3
and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde.
Molecular Properties
| Compound Name | 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde |
| PubChem CID | 23291880 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde |
| SMILES | NC1CCCCC1.NCC(=O)O.O=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H5F3O.C6H13N.C2H5NO2/c9-8(10,11)7-3-1-6(5-12)2-4-7;7-6-4-2-1-3-5-6;3-1-2(4)5/h1-5H;6H,1-5,7H2;1,3H2,(H,4,5) |
| InChIKey | SVXFFPIYGDOTFM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde?
The IUPAC name of 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde (CID 23291880) is 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde.
What is the SMILES notation for 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde?
The canonical SMILES for 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde is NC1CCCCC1.NCC(=O)O.O=Cc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde?
The InChIKey is SVXFFPIYGDOTFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3O.C6H13N.C2H5NO2/c9-8(10,11)7-3-1-6(5-12)2-4-7;7-6-4-2-1-3-5-6;3-1-2(4)5/h1-5H;6H,1-5,7H2;1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde?
2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde has a molecular weight of 348.37 g/mol, XLogP of 2.83, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;cyclohexanamine;4-(trifluoromethyl)benzaldehyde is sourced from PubChem (CID 23291880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).