C17H13Cl2NO3 — CID 23292237
2-[[(E)-3-(3,4-dichlorophenyl)-2-methylprop-2-enoyl]amino]benzoic acid (PubChem CID 23292237) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-[[(E)-3-(3,4-dichlorophenyl)-2-methylprop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-(3,4-dichlorophenyl)-2-methylprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23292237 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[[(E)-3-(3,4-dichlorophenyl)-2-methylprop-2-enoyl]amino]benzoic acid |
| SMILES | C/C(=C\c1ccc(Cl)c(Cl)c1)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C17H13Cl2NO3/c1-10(8-11-6-7-13(18)14(19)9-11)16(21)20-15-5-3-2-4-12(15)17(22)23/h2-9H,1H3,(H,20,21)(H,22,23)/b10-8+ |
| InChIKey | BNXVGPPJQGHXPH-CSKARUKUSA-N |
| XLogP | 4.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|