About 2,2-dicyclohexylpropane-1,3-diol
2,2-dicyclohexylpropane-1,3-diol (PubChem CID 23292670) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2,2-dicyclohexylpropane-1,3-diol.
Molecular Properties
| Compound Name | 2,2-dicyclohexylpropane-1,3-diol |
| PubChem CID | 23292670 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2,2-dicyclohexylpropane-1,3-diol |
| SMILES | OCC(CO)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H28O2/c16-11-15(12-17,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h13-14,16-17H,1-12H2 |
| InChIKey | OVOVXMVFDJXHAN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dicyclohexylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyclohexylpropane-1,3-diol?
The IUPAC name of 2,2-dicyclohexylpropane-1,3-diol (CID 23292670) is 2,2-dicyclohexylpropane-1,3-diol.
What is the SMILES notation for 2,2-dicyclohexylpropane-1,3-diol?
The canonical SMILES for 2,2-dicyclohexylpropane-1,3-diol is OCC(CO)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 2,2-dicyclohexylpropane-1,3-diol?
The InChIKey is OVOVXMVFDJXHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c16-11-15(12-17,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h13-14,16-17H,1-12H2.
What are the key properties of 2,2-dicyclohexylpropane-1,3-diol?
2,2-dicyclohexylpropane-1,3-diol has a molecular weight of 240.39 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyclohexylpropane-1,3-diol is sourced from PubChem (CID 23292670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).