C24H27NOSi — CID 23292700
N-benzhydryl-3-[dimethyl(phenyl)silyl]propanamide (PubChem CID 23292700) has the molecular formula C24H27NOSi and a molecular weight of 373.57 g/mol. Its IUPAC name is N-benzhydryl-3-[dimethyl(phenyl)silyl]propanamide.
| Compound Name | N-benzhydryl-3-[dimethyl(phenyl)silyl]propanamide |
|---|---|
| PubChem CID | 23292700 |
| Molecular Formula | C24H27NOSi |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-benzhydryl-3-[dimethyl(phenyl)silyl]propanamide |
| SMILES | C[Si](C)(CCC(=O)NC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27NOSi/c1-27(2,22-16-10-5-11-17-22)19-18-23(26)25-24(20-12-6-3-7-13-20)21-14-8-4-9-15-21/h3-17,24H,18-19H2,1-2H3,(H,25,26) |
| InChIKey | OEVYLOMOWMGJMD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|