About N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide
N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide (PubChem CID 23292742) has the molecular formula C22H42N2O2
and a molecular weight of 366.59 g/mol. Its IUPAC name is N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide.
Molecular Properties
| Compound Name | N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide |
| PubChem CID | 23292742 |
| Molecular Formula | C22H42N2O2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.32 |
| IUPAC Name | N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide |
| SMILES | CCCC(=O)NC1CC(NC(=O)CCC)CC(C(C)CC)(C(C)CC)C1 |
| InChI | InChI=1S/C22H42N2O2/c1-7-11-20(25)23-18-13-19(24-21(26)12-8-2)15-22(14-18,16(5)9-3)17(6)10-4/h16-19H,7-15H2,1-6H3,(H,23,25)(H,24,26) |
| InChIKey | AJQNIKRRIDLYBF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide?
The IUPAC name of N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide (CID 23292742) is N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide.
What is the SMILES notation for N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide?
The canonical SMILES for N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide is CCCC(=O)NC1CC(NC(=O)CCC)CC(C(C)CC)(C(C)CC)C1.
What is the InChIKey of N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide?
The InChIKey is AJQNIKRRIDLYBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42N2O2/c1-7-11-20(25)23-18-13-19(24-21(26)12-8-2)15-22(14-18,16(5)9-3)17(6)10-4/h16-19H,7-15H2,1-6H3,(H,23,25)(H,24,26).
What are the key properties of N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide?
N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide has a molecular weight of 366.59 g/mol, XLogP of 4.82, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(butanoylamino)-3,3-di(butan-2-yl)cyclohexyl]butanamide is sourced from PubChem (CID 23292742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).