C17H14F6N4OS2 — CID 23293874
2-[1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)furo[2,3-c]pyridin-5-yl]ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine (PubChem CID 23293874) has the molecular formula C17H14F6N4OS2 and a molecular weight of 468.45 g/mol. Its IUPAC name is 2-[1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)furo[2,3-c]pyridin-5-yl]ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | 2-[1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)furo[2,3-c]pyridin-5-yl]ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23293874 |
| Molecular Formula | C17H14F6N4OS2 |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-[1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)furo[2,3-c]pyridin-5-yl]ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1cc(N)nc(SC(C)c2cc3c(C(C(F)(F)F)C(F)(F)F)coc3cn2)n1 |
| InChI | InChI=1S/C17H14F6N4OS2/c1-7(30-15-26-12(24)4-13(27-15)29-2)10-3-8-9(6-28-11(8)5-25-10)14(16(18,19)20)17(21,22)23/h3-7,14H,1-2H3,(H2,24,26,27) |
| InChIKey | IRBVXIAESNTDCE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |