About 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine
2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine (PubChem CID 23293969) has the molecular formula C14H13BrN4S3
and a molecular weight of 413.39 g/mol. Its IUPAC name is 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
| PubChem CID | 23293969 |
| Molecular Formula | C14H13BrN4S3 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 411.95 |
| IUPAC Name | 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1cc(N)nc(SC(C)c2cc3c(Br)csc3cn2)n1 |
| InChI | InChI=1S/C14H13BrN4S3/c1-7(22-14-18-12(16)4-13(19-14)20-2)10-3-8-9(15)6-21-11(8)5-17-10/h3-7H,1-2H3,(H2,16,18,19) |
| InChIKey | KRWKSUBOPGVEOT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine?
The IUPAC name of 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine (CID 23293969) is 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine.
What is the SMILES notation for 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine?
The canonical SMILES for 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine is CSc1cc(N)nc(SC(C)c2cc3c(Br)csc3cn2)n1.
What is the InChIKey of 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine?
The InChIKey is KRWKSUBOPGVEOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN4S3/c1-7(22-14-18-12(16)4-13(19-14)20-2)10-3-8-9(15)6-21-11(8)5-17-10/h3-7H,1-2H3,(H2,16,18,19).
What are the key properties of 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine?
2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine has a molecular weight of 413.39 g/mol, XLogP of 5.01, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-bromothieno[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine is sourced from PubChem (CID 23293969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).