About 2-butan-2-yloxybutane
2-butan-2-yloxybutane (PubChem CID 23294) has the molecular formula C8H18O
and a molecular weight of 130.23 g/mol. Its IUPAC name is 2-butan-2-yloxybutane.
Molecular Properties
| Compound Name | 2-butan-2-yloxybutane |
| PubChem CID | 23294 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.14 |
| IUPAC Name | 2-butan-2-yloxybutane |
| SMILES | CCC(C)OC(C)CC |
| InChI | InChI=1S/C8H18O/c1-5-7(3)9-8(4)6-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | HHBZZTKMMLDNDN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butan-2-yloxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yloxybutane?
The IUPAC name of 2-butan-2-yloxybutane (CID 23294) is 2-butan-2-yloxybutane.
What is the SMILES notation for 2-butan-2-yloxybutane?
The canonical SMILES for 2-butan-2-yloxybutane is CCC(C)OC(C)CC.
What is the InChIKey of 2-butan-2-yloxybutane?
The InChIKey is HHBZZTKMMLDNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O/c1-5-7(3)9-8(4)6-2/h7-8H,5-6H2,1-4H3.
What are the key properties of 2-butan-2-yloxybutane?
2-butan-2-yloxybutane has a molecular weight of 130.23 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yloxybutane is sourced from PubChem (CID 23294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).