C18H17F6N5S2 — CID 23294068
2-[1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine (PubChem CID 23294068) has the molecular formula C18H17F6N5S2 and a molecular weight of 481.49 g/mol. Its IUPAC name is 2-[1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | 2-[1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23294068 |
| Molecular Formula | C18H17F6N5S2 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 2-[1-[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]ethylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1cc(N)nc(SC(C)c2cc3c(C(C(F)(F)F)C(F)(F)F)cn(C)c3cn2)n1 |
| InChI | InChI=1S/C18H17F6N5S2/c1-8(31-16-27-13(25)5-14(28-16)30-3)11-4-9-10(7-29(2)12(9)6-26-11)15(17(19,20)21)18(22,23)24/h4-8,15H,1-3H3,(H2,25,27,28) |
| InChIKey | DAPYTBVCUVROLH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |