C8H14N2OS — CID 23294146
3-hexan-2-yloxy-1,2,5-thiadiazole (PubChem CID 23294146) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 3-hexan-2-yloxy-1,2,5-thiadiazole.
| Compound Name | 3-hexan-2-yloxy-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 23294146 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-hexan-2-yloxy-1,2,5-thiadiazole |
| SMILES | CCCCC(C)Oc1cnsn1 |
| InChI | InChI=1S/C8H14N2OS/c1-3-4-5-7(2)11-8-6-9-12-10-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | BMASOMSXVMFTHF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |