About 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate
2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate (PubChem CID 23294906) has the molecular formula C19H27N3O6
and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate |
| PubChem CID | 23294906 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate |
| SMILES | CC(C)N(CCOC(=O)C1(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCC1)C(C)C |
| InChI | InChI=1S/C19H27N3O6/c1-13(2)20(14(3)4)10-11-28-18(23)19(8-5-9-19)16-7-6-15(21(24)25)12-17(16)22(26)27/h6-7,12-14H,5,8-11H2,1-4H3 |
| InChIKey | ICGZDOITAJNNOH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate?
The IUPAC name of 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate (CID 23294906) is 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate.
What is the SMILES notation for 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate?
The canonical SMILES for 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate is CC(C)N(CCOC(=O)C1(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCC1)C(C)C.
What is the InChIKey of 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate?
The InChIKey is ICGZDOITAJNNOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O6/c1-13(2)20(14(3)4)10-11-28-18(23)19(8-5-9-19)16-7-6-15(21(24)25)12-17(16)22(26)27/h6-7,12-14H,5,8-11H2,1-4H3.
What are the key properties of 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate?
2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate has a molecular weight of 393.44 g/mol, XLogP of 3.59, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[di(propan-2-yl)amino]ethyl 1-(2,4-dinitrophenyl)cyclobutane-1-carboxylate is sourced from PubChem (CID 23294906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).