About [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane
[4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane (PubChem CID 23295273) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane.
Molecular Properties
| Compound Name | [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane |
| PubChem CID | 23295273 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane |
| SMILES | CC(C)C1=C(C(C)C)C(C2CCCCC2)=CC1 |
| InChI | InChI=1S/C17H28/c1-12(2)15-10-11-16(17(15)13(3)4)14-8-6-5-7-9-14/h11-14H,5-10H2,1-4H3 |
| InChIKey | ALWMNXHUGONLJH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane?
The IUPAC name of [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane (CID 23295273) is [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane.
What is the SMILES notation for [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane?
The canonical SMILES for [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane is CC(C)C1=C(C(C)C)C(C2CCCCC2)=CC1.
What is the InChIKey of [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane?
The InChIKey is ALWMNXHUGONLJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-12(2)15-10-11-16(17(15)13(3)4)14-8-6-5-7-9-14/h11-14H,5-10H2,1-4H3.
What are the key properties of [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane?
[4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane has a molecular weight of 232.41 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-di(propan-2-yl)cyclopenta-1,4-dien-1-yl]cyclohexane is sourced from PubChem (CID 23295273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).