C19H35N — CID 23295285
1-(4,5-dipentylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine (PubChem CID 23295285) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is 1-(4,5-dipentylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine.
| Compound Name | 1-(4,5-dipentylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 23295285 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 1-(4,5-dipentylcyclopenta-1,4-dien-1-yl)-N,N-dimethylethanamine |
| SMILES | CCCCCC1=C(CCCCC)C(C(C)N(C)C)=CC1 |
| InChI | InChI=1S/C19H35N/c1-6-8-10-12-17-14-15-18(16(3)20(4)5)19(17)13-11-9-7-2/h15-16H,6-14H2,1-5H3 |
| InChIKey | ZNZTUCBMLIUAPS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|