About adamantane;2-methylpropane
adamantane;2-methylpropane (PubChem CID 23295562) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is adamantane;2-methylpropane.
Molecular Properties
| Compound Name | adamantane;2-methylpropane |
| PubChem CID | 23295562 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | adamantane;2-methylpropane |
| SMILES | C1C2CC3CC1CC(C2)C3.CC(C)C |
| InChI | InChI=1S/C10H16.C4H10/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-4(2)3/h7-10H,1-6H2;4H,1-3H3 |
| InChIKey | AKENPGKLTAAUIQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;2-methylpropane?
The IUPAC name of adamantane;2-methylpropane (CID 23295562) is adamantane;2-methylpropane.
What is the SMILES notation for adamantane;2-methylpropane?
The canonical SMILES for adamantane;2-methylpropane is C1C2CC3CC1CC(C2)C3.CC(C)C.
What is the InChIKey of adamantane;2-methylpropane?
The InChIKey is AKENPGKLTAAUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C4H10/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-4(2)3/h7-10H,1-6H2;4H,1-3H3.
What are the key properties of adamantane;2-methylpropane?
adamantane;2-methylpropane has a molecular weight of 194.36 g/mol, XLogP of 4.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;2-methylpropane is sourced from PubChem (CID 23295562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).