C32H27BrO5S2 — CID 23296009
2-[4-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-2-cyclopentylphenoxy]sulfonylbenzoic acid (PubChem CID 23296009) has the molecular formula C32H27BrO5S2 and a molecular weight of 635.60 g/mol. Its IUPAC name is 2-[4-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-2-cyclopentylphenoxy]sulfonylbenzoic acid.
| Compound Name | 2-[4-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-2-cyclopentylphenoxy]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 23296009 |
| Molecular Formula | C32H27BrO5S2 |
| Molecular Weight | 635.60 g/mol |
| Exact Mass | 634.05 |
| IUPAC Name | 2-[4-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-2-cyclopentylphenoxy]sulfonylbenzoic acid |
| SMILES | Cc1sc2c(Br)c3ccccc3c(-c3ccc(OS(=O)(=O)c4ccccc4C(=O)O)c(C4CCCC4)c3)c2c1C |
| InChI | InChI=1S/C32H27BrO5S2/c1-18-19(2)39-31-28(18)29(22-11-5-6-12-23(22)30(31)33)21-15-16-26(25(17-21)20-9-3-4-10-20)38-40(36,37)27-14-8-7-13-24(27)32(34)35/h5-8,11-17,20H,3-4,9-10H2,1-2H3,(H,34,35) |
| InChIKey | UCRCHCAAWIKMGU-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.60 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|