C11H19NO2 — CID 23296137
2-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl)acetic acid (PubChem CID 23296137) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl)acetic acid.
| Compound Name | 2-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl)acetic acid |
|---|---|
| PubChem CID | 23296137 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl)acetic acid |
| SMILES | O=C(O)CC1CCN2CCCCC2C1 |
| InChI | InChI=1S/C11H19NO2/c13-11(14)8-9-4-6-12-5-2-1-3-10(12)7-9/h9-10H,1-8H2,(H,13,14) |
| InChIKey | QLCCMSWLJFXTGN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |