About 2,3-dihydro-1H-indole;ethanamine
2,3-dihydro-1H-indole;ethanamine (PubChem CID 23296774) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;ethanamine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indole;ethanamine |
| PubChem CID | 23296774 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2,3-dihydro-1H-indole;ethanamine |
| SMILES | CCN.c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H9N.C2H7N/c1-2-4-8-7(3-1)5-6-9-8;1-2-3/h1-4,9H,5-6H2;2-3H2,1H3 |
| InChIKey | OYTVTSJLKZCWQL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-1H-indole;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indole;ethanamine?
The IUPAC name of 2,3-dihydro-1H-indole;ethanamine (CID 23296774) is 2,3-dihydro-1H-indole;ethanamine.
What is the SMILES notation for 2,3-dihydro-1H-indole;ethanamine?
The canonical SMILES for 2,3-dihydro-1H-indole;ethanamine is CCN.c1ccc2c(c1)CCN2.
What is the InChIKey of 2,3-dihydro-1H-indole;ethanamine?
The InChIKey is OYTVTSJLKZCWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.C2H7N/c1-2-4-8-7(3-1)5-6-9-8;1-2-3/h1-4,9H,5-6H2;2-3H2,1H3.
What are the key properties of 2,3-dihydro-1H-indole;ethanamine?
2,3-dihydro-1H-indole;ethanamine has a molecular weight of 164.25 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indole;ethanamine is sourced from PubChem (CID 23296774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).