(4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate

C7H12O6 — CID 23296804

IUPAC(4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate
SMILESCC(COC(=O)O)C(C)OC(=O)O
InChIInChI=1S/C7H12O6/c1-4(3-12-6(8)9)5(2)13-7(10)11/h4-5H,3H2,1-2H3,(H,8,9)(H,10,11)
InChIKeyWYRDKGJSENQPLI-UHFFFAOYSA-N
MW192.17 g/mol
LogP1.40
Rot. Bonds4

About (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate

(4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate (PubChem CID 23296804) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate.

Molecular Properties

Compound Name(4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate
PubChem CID23296804
Molecular FormulaC7H12O6
Molecular Weight192.17 g/mol
Exact Mass192.06
IUPAC Name(4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate
SMILESCC(COC(=O)O)C(C)OC(=O)O
InChIInChI=1S/C7H12O6/c1-4(3-12-6(8)9)5(2)13-7(10)11/h4-5H,3H2,1-2H3,(H,8,9)(H,10,11)
InChIKeyWYRDKGJSENQPLI-UHFFFAOYSA-N
XLogP1.40
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 51.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate?
The IUPAC name of (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate (CID 23296804) is (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate.
What is the SMILES notation for (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate?
The canonical SMILES for (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate is CC(COC(=O)O)C(C)OC(=O)O.
What is the InChIKey of (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate?
The InChIKey is WYRDKGJSENQPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O6/c1-4(3-12-6(8)9)5(2)13-7(10)11/h4-5H,3H2,1-2H3,(H,8,9)(H,10,11).
What are the key properties of (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate?
(4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate has a molecular weight of 192.17 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carboxyoxy-3-methylbutan-2-yl) hydrogen carbonate is sourced from PubChem (CID 23296804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).