About 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide
3-(2,3-diethylphenyl)pentan-3-ylazanium bromide (PubChem CID 23296859) has the molecular formula C15H26BrN
and a molecular weight of 300.28 g/mol. Its IUPAC name is 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide.
Molecular Properties
| Compound Name | 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide |
| PubChem CID | 23296859 |
| Molecular Formula | C15H26BrN |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide |
| SMILES | CCc1cccc(C([NH3+])(CC)CC)c1CC.[Br-] |
| InChI | InChI=1S/C15H25N.BrH/c1-5-12-10-9-11-14(13(12)6-2)15(16,7-3)8-4;/h9-11H,5-8,16H2,1-4H3;1H |
| InChIKey | BYJSMJIQEARQMC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide?
The IUPAC name of 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide (CID 23296859) is 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide.
What is the SMILES notation for 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide?
The canonical SMILES for 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide is CCc1cccc(C([NH3+])(CC)CC)c1CC.[Br-].
What is the InChIKey of 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide?
The InChIKey is BYJSMJIQEARQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N.BrH/c1-5-12-10-9-11-14(13(12)6-2)15(16,7-3)8-4;/h9-11H,5-8,16H2,1-4H3;1H.
What are the key properties of 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide?
3-(2,3-diethylphenyl)pentan-3-ylazanium bromide has a molecular weight of 300.28 g/mol, XLogP of 0.07, 5 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-diethylphenyl)pentan-3-ylazanium bromide is sourced from PubChem (CID 23296859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).