C8H15NO3 — CID 23297267
N,N-bis(1-hydroxyethyl)-2-methylprop-2-enamide (PubChem CID 23297267) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N,N-bis(1-hydroxyethyl)-2-methylprop-2-enamide.
| Compound Name | N,N-bis(1-hydroxyethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 23297267 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N,N-bis(1-hydroxyethyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C(C)O)C(C)O |
| InChI | InChI=1S/C8H15NO3/c1-5(2)8(12)9(6(3)10)7(4)11/h6-7,10-11H,1H2,2-4H3 |
| InChIKey | MJGTXMYGIOPHBL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|