C12H24Cl2OSi — CID 23297343
2,2-dichloro-3,3,4,4,5,5,6,6-octamethyloxasilinane (PubChem CID 23297343) has the molecular formula C12H24Cl2OSi and a molecular weight of 283.31 g/mol. Its IUPAC name is 2,2-dichloro-3,3,4,4,5,5,6,6-octamethyloxasilinane.
| Compound Name | 2,2-dichloro-3,3,4,4,5,5,6,6-octamethyloxasilinane |
|---|---|
| PubChem CID | 23297343 |
| Molecular Formula | C12H24Cl2OSi |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2,2-dichloro-3,3,4,4,5,5,6,6-octamethyloxasilinane |
| SMILES | CC1(C)O[Si](Cl)(Cl)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H24Cl2OSi/c1-9(2)10(3,4)12(7,8)16(13,14)15-11(9,5)6/h1-8H3 |
| InChIKey | ZZFLQWQHLDLRBH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|