About 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene
8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene (PubChem CID 23297377) has the molecular formula C20H38O
and a molecular weight of 294.52 g/mol. Its IUPAC name is 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene.
Molecular Properties
| Compound Name | 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene |
| PubChem CID | 23297377 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCCC(C)CCOCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C20H38O/c1-17(2)9-7-11-19(5)13-15-21-16-14-20(6)12-8-10-18(3)4/h9-10,19-20H,7-8,11-16H2,1-6H3 |
| InChIKey | WAPFYBFRMDEWMB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene?
The IUPAC name of 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene (CID 23297377) is 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene.
What is the SMILES notation for 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene?
The canonical SMILES for 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene is CC(C)=CCCC(C)CCOCCC(C)CCC=C(C)C.
What is the InChIKey of 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene?
The InChIKey is WAPFYBFRMDEWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O/c1-17(2)9-7-11-19(5)13-15-21-16-14-20(6)12-8-10-18(3)4/h9-10,19-20H,7-8,11-16H2,1-6H3.
What are the key properties of 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene?
8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene has a molecular weight of 294.52 g/mol, XLogP of 6.55, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,7-dimethyloct-6-enoxy)-2,6-dimethyloct-2-ene is sourced from PubChem (CID 23297377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).