About 2-bromonaphthalene-1,8-diol
2-bromonaphthalene-1,8-diol (PubChem CID 23297382) has the molecular formula C10H7BrO2
and a molecular weight of 239.07 g/mol. Its IUPAC name is 2-bromonaphthalene-1,8-diol.
Molecular Properties
| Compound Name | 2-bromonaphthalene-1,8-diol |
| PubChem CID | 23297382 |
| Molecular Formula | C10H7BrO2 |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 2-bromonaphthalene-1,8-diol |
| SMILES | Oc1cccc2ccc(Br)c(O)c12 |
| InChI | InChI=1S/C10H7BrO2/c11-7-5-4-6-2-1-3-8(12)9(6)10(7)13/h1-5,12-13H |
| InChIKey | BNFMJVXMUSCSFQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromonaphthalene-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromonaphthalene-1,8-diol?
The IUPAC name of 2-bromonaphthalene-1,8-diol (CID 23297382) is 2-bromonaphthalene-1,8-diol.
What is the SMILES notation for 2-bromonaphthalene-1,8-diol?
The canonical SMILES for 2-bromonaphthalene-1,8-diol is Oc1cccc2ccc(Br)c(O)c12.
What is the InChIKey of 2-bromonaphthalene-1,8-diol?
The InChIKey is BNFMJVXMUSCSFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO2/c11-7-5-4-6-2-1-3-8(12)9(6)10(7)13/h1-5,12-13H.
What are the key properties of 2-bromonaphthalene-1,8-diol?
2-bromonaphthalene-1,8-diol has a molecular weight of 239.07 g/mol, XLogP of 3.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromonaphthalene-1,8-diol is sourced from PubChem (CID 23297382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).