About azane;piperidine-1-carboxamide
azane;piperidine-1-carboxamide (PubChem CID 23297547) has the molecular formula C6H15N3O
and a molecular weight of 145.21 g/mol. Its IUPAC name is azane;piperidine-1-carboxamide.
Molecular Properties
| Compound Name | azane;piperidine-1-carboxamide |
| PubChem CID | 23297547 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | azane;piperidine-1-carboxamide |
| SMILES | N.NC(=O)N1CCCCC1 |
| InChI | InChI=1S/C6H12N2O.H3N/c7-6(9)8-4-2-1-3-5-8;/h1-5H2,(H2,7,9);1H3 |
| InChIKey | IPQZUIKANYAGGC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;piperidine-1-carboxamide?
The IUPAC name of azane;piperidine-1-carboxamide (CID 23297547) is azane;piperidine-1-carboxamide.
What is the SMILES notation for azane;piperidine-1-carboxamide?
The canonical SMILES for azane;piperidine-1-carboxamide is N.NC(=O)N1CCCCC1.
What is the InChIKey of azane;piperidine-1-carboxamide?
The InChIKey is IPQZUIKANYAGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.H3N/c7-6(9)8-4-2-1-3-5-8;/h1-5H2,(H2,7,9);1H3.
What are the key properties of azane;piperidine-1-carboxamide?
azane;piperidine-1-carboxamide has a molecular weight of 145.21 g/mol, XLogP of 0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;piperidine-1-carboxamide is sourced from PubChem (CID 23297547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).