About 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline
5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline (PubChem CID 23297968) has the molecular formula C11H10FN5O2
and a molecular weight of 263.23 g/mol. Its IUPAC name is 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline.
Molecular Properties
| Compound Name | 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline |
| PubChem CID | 23297968 |
| Molecular Formula | C11H10FN5O2 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline |
| SMILES | COc1nc2cc(F)cc(CN=[N+]=[N-])c2nc1OC |
| InChI | InChI=1S/C11H10FN5O2/c1-18-10-11(19-2)16-9-6(5-14-17-13)3-7(12)4-8(9)15-10/h3-4H,5H2,1-2H3 |
| InChIKey | OKCLJPNHVQXYQL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline?
The IUPAC name of 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline (CID 23297968) is 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline.
What is the SMILES notation for 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline?
The canonical SMILES for 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline is COc1nc2cc(F)cc(CN=[N+]=[N-])c2nc1OC.
What is the InChIKey of 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline?
The InChIKey is OKCLJPNHVQXYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN5O2/c1-18-10-11(19-2)16-9-6(5-14-17-13)3-7(12)4-8(9)15-10/h3-4H,5H2,1-2H3.
What are the key properties of 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline?
5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline has a molecular weight of 263.23 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(azidomethyl)-7-fluoro-2,3-dimethoxyquinoxaline is sourced from PubChem (CID 23297968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).