About 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline
5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline (PubChem CID 23298034) has the molecular formula C11H10BrFN2O2
and a molecular weight of 301.12 g/mol. Its IUPAC name is 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline.
Molecular Properties
| Compound Name | 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline |
| PubChem CID | 23298034 |
| Molecular Formula | C11H10BrFN2O2 |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline |
| SMILES | COc1nc2cc(F)cc(CBr)c2nc1OC |
| InChI | InChI=1S/C11H10BrFN2O2/c1-16-10-11(17-2)15-9-6(5-12)3-7(13)4-8(9)14-10/h3-4H,5H2,1-2H3 |
| InChIKey | IMPMNLFMEPKUHP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline?
The IUPAC name of 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline (CID 23298034) is 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline.
What is the SMILES notation for 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline?
The canonical SMILES for 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline is COc1nc2cc(F)cc(CBr)c2nc1OC.
What is the InChIKey of 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline?
The InChIKey is IMPMNLFMEPKUHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrFN2O2/c1-16-10-11(17-2)15-9-6(5-12)3-7(13)4-8(9)14-10/h3-4H,5H2,1-2H3.
What are the key properties of 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline?
5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline has a molecular weight of 301.12 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-7-fluoro-2,3-dimethoxyquinoxaline is sourced from PubChem (CID 23298034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).