About 7-fluoro-2,3-dimethoxy-5-methylquinoxaline
7-fluoro-2,3-dimethoxy-5-methylquinoxaline (PubChem CID 23298052) has the molecular formula C11H11FN2O2
and a molecular weight of 222.22 g/mol. Its IUPAC name is 7-fluoro-2,3-dimethoxy-5-methylquinoxaline.
Molecular Properties
| Compound Name | 7-fluoro-2,3-dimethoxy-5-methylquinoxaline |
| PubChem CID | 23298052 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 7-fluoro-2,3-dimethoxy-5-methylquinoxaline |
| SMILES | COc1nc2cc(F)cc(C)c2nc1OC |
| InChI | InChI=1S/C11H11FN2O2/c1-6-4-7(12)5-8-9(6)14-11(16-3)10(13-8)15-2/h4-5H,1-3H3 |
| InChIKey | KTLIKCGDJMYANC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-fluoro-2,3-dimethoxy-5-methylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,3-dimethoxy-5-methylquinoxaline?
The IUPAC name of 7-fluoro-2,3-dimethoxy-5-methylquinoxaline (CID 23298052) is 7-fluoro-2,3-dimethoxy-5-methylquinoxaline.
What is the SMILES notation for 7-fluoro-2,3-dimethoxy-5-methylquinoxaline?
The canonical SMILES for 7-fluoro-2,3-dimethoxy-5-methylquinoxaline is COc1nc2cc(F)cc(C)c2nc1OC.
What is the InChIKey of 7-fluoro-2,3-dimethoxy-5-methylquinoxaline?
The InChIKey is KTLIKCGDJMYANC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O2/c1-6-4-7(12)5-8-9(6)14-11(16-3)10(13-8)15-2/h4-5H,1-3H3.
What are the key properties of 7-fluoro-2,3-dimethoxy-5-methylquinoxaline?
7-fluoro-2,3-dimethoxy-5-methylquinoxaline has a molecular weight of 222.22 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,3-dimethoxy-5-methylquinoxaline is sourced from PubChem (CID 23298052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).