C24H28ClFN2O3 — CID 23298163
7a-[8-[3-(4-fluorophenoxy)propyl]-8-azabicyclo[3.2.1]octan-3-yl]-3aH-isoindole-1,3-dione;hydrochloride (PubChem CID 23298163) has the molecular formula C24H28ClFN2O3 and a molecular weight of 446.95 g/mol. Its IUPAC name is 7a-[8-[3-(4-fluorophenoxy)propyl]-8-azabicyclo[3.2.1]octan-3-yl]-3aH-isoindole-1,3-dione;hydrochloride.
| Compound Name | 7a-[8-[3-(4-fluorophenoxy)propyl]-8-azabicyclo[3.2.1]octan-3-yl]-3aH-isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 23298163 |
| Molecular Formula | C24H28ClFN2O3 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 7a-[8-[3-(4-fluorophenoxy)propyl]-8-azabicyclo[3.2.1]octan-3-yl]-3aH-isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1NC(=O)C2(C3CC4CCC(C3)N4CCCOc3ccc(F)cc3)C=CC=CC12 |
| InChI | InChI=1S/C24H27FN2O3.ClH/c25-17-5-9-20(10-6-17)30-13-3-12-27-18-7-8-19(27)15-16(14-18)24-11-2-1-4-21(24)22(28)26-23(24)29;/h1-2,4-6,9-11,16,18-19,21H,3,7-8,12-15H2,(H,26,28,29);1H |
| InChIKey | PHZZMFLMPIHBTK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|