C38H31N3O3S — CID 23298287
5-[[4-[(1-methylpyrrolo[2,3-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 23298287) has the molecular formula C38H31N3O3S and a molecular weight of 609.75 g/mol. Its IUPAC name is 5-[[4-[(1-methylpyrrolo[2,3-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(1-methylpyrrolo[2,3-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23298287 |
| Molecular Formula | C38H31N3O3S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 5-[[4-[(1-methylpyrrolo[2,3-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1c(COc2ccc(CC3SC(=O)N(C(c4ccccc4)(c4ccccc4)c4ccccc4)C3=O)cc2)cc2cccnc21 |
| InChI | InChI=1S/C38H31N3O3S/c1-40-32(25-28-12-11-23-39-35(28)40)26-44-33-21-19-27(20-22-33)24-34-36(42)41(37(43)45-34)38(29-13-5-2-6-14-29,30-15-7-3-8-16-30)31-17-9-4-10-18-31/h2-23,25,34H,24,26H2,1H3 |
| InChIKey | LUIVVDKUFUNCGY-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|