About 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one
3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one (PubChem CID 23298376) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one.
Molecular Properties
| Compound Name | 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one |
| PubChem CID | 23298376 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one |
| SMILES | Cc1cc2ncn(C)c2[nH]c1=O |
| InChI | InChI=1S/C8H9N3O/c1-5-3-6-7(10-8(5)12)11(2)4-9-6/h3-4H,1-2H3,(H,10,12) |
| InChIKey | VNDUDJJIPMFKLT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one?
The IUPAC name of 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one (CID 23298376) is 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one.
What is the SMILES notation for 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one?
The canonical SMILES for 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one is Cc1cc2ncn(C)c2[nH]c1=O.
What is the InChIKey of 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one?
The InChIKey is VNDUDJJIPMFKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-3-6-7(10-8(5)12)11(2)4-9-6/h3-4H,1-2H3,(H,10,12).
What are the key properties of 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one?
3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one has a molecular weight of 163.18 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-4H-imidazo[4,5-b]pyridin-5-one is sourced from PubChem (CID 23298376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).