About 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol
5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol (PubChem CID 23298595) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol.
Molecular Properties
| Compound Name | 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol |
| PubChem CID | 23298595 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol |
| SMILES | NCC(O)CO.Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C10H9NO.C3H9NO2/c11-9-5-1-4-8-7(9)3-2-6-10(8)12;4-1-3(6)2-5/h1-6,12H,11H2;3,5-6H,1-2,4H2 |
| InChIKey | ZKIQTJSRLONRKH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol?
The IUPAC name of 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol (CID 23298595) is 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol.
What is the SMILES notation for 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol?
The canonical SMILES for 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol is NCC(O)CO.Nc1cccc2c(O)cccc12.
What is the InChIKey of 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol?
The InChIKey is ZKIQTJSRLONRKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C3H9NO2/c11-9-5-1-4-8-7(9)3-2-6-10(8)12;4-1-3(6)2-5/h1-6,12H,11H2;3,5-6H,1-2,4H2.
What are the key properties of 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol?
5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol has a molecular weight of 250.30 g/mol, XLogP of 0.43, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminonaphthalen-1-ol;3-aminopropane-1,2-diol is sourced from PubChem (CID 23298595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).