About 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid
4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid (PubChem CID 23298651) has the molecular formula C21H21NO5S
and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid.
Molecular Properties
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid |
| PubChem CID | 23298651 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid |
| SMILES | COc1ccc(SCC(CC(C)N2C(=O)c3ccccc3C2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C21H21NO5S/c1-13(22-19(23)17-5-3-4-6-18(17)20(22)24)11-14(21(25)26)12-28-16-9-7-15(27-2)8-10-16/h3-10,13-14H,11-12H2,1-2H3,(H,25,26) |
| InChIKey | LMXQQSJOXVMVRE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid?
The IUPAC name of 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid (CID 23298651) is 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid.
What is the SMILES notation for 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid?
The canonical SMILES for 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid is COc1ccc(SCC(CC(C)N2C(=O)c3ccccc3C2=O)C(=O)O)cc1.
What is the InChIKey of 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid?
The InChIKey is LMXQQSJOXVMVRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO5S/c1-13(22-19(23)17-5-3-4-6-18(17)20(22)24)11-14(21(25)26)12-28-16-9-7-15(27-2)8-10-16/h3-10,13-14H,11-12H2,1-2H3,(H,25,26).
What are the key properties of 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid?
4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid has a molecular weight of 399.47 g/mol, XLogP of 3.56, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]pentanoic acid is sourced from PubChem (CID 23298651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).