C12H16N4O — CID 23298690
1-ethyl-5-(2-methoxyphenyl)pyrazole-3,4-diamine (PubChem CID 23298690) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 1-ethyl-5-(2-methoxyphenyl)pyrazole-3,4-diamine.
| Compound Name | 1-ethyl-5-(2-methoxyphenyl)pyrazole-3,4-diamine |
|---|---|
| PubChem CID | 23298690 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-ethyl-5-(2-methoxyphenyl)pyrazole-3,4-diamine |
| SMILES | CCn1nc(N)c(N)c1-c1ccccc1OC |
| InChI | InChI=1S/C12H16N4O/c1-3-16-11(10(13)12(14)15-16)8-6-4-5-7-9(8)17-2/h4-7H,3,13H2,1-2H3,(H2,14,15) |
| InChIKey | OWXJHZWICWMSQV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |