C14H21N3O3 — CID 23299305
2-amino-2-(1-aminoethyl)-3-oxo-4-(2-phenylethylamino)butanoic acid (PubChem CID 23299305) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-amino-2-(1-aminoethyl)-3-oxo-4-(2-phenylethylamino)butanoic acid.
| Compound Name | 2-amino-2-(1-aminoethyl)-3-oxo-4-(2-phenylethylamino)butanoic acid |
|---|---|
| PubChem CID | 23299305 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-amino-2-(1-aminoethyl)-3-oxo-4-(2-phenylethylamino)butanoic acid |
| SMILES | CC(N)C(N)(C(=O)O)C(=O)CNCCc1ccccc1 |
| InChI | InChI=1S/C14H21N3O3/c1-10(15)14(16,13(19)20)12(18)9-17-8-7-11-5-3-2-4-6-11/h2-6,10,17H,7-9,15-16H2,1H3,(H,19,20) |
| InChIKey | GJBSEKWPPHDYMD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|