C14H18N2O5 — CID 23299565
2-[3-[3-(2-aminoethoxymethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]acetic acid (PubChem CID 23299565) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[3-[3-(2-aminoethoxymethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]acetic acid.
| Compound Name | 2-[3-[3-(2-aminoethoxymethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 23299565 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[3-[3-(2-aminoethoxymethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]acetic acid |
| SMILES | NCCOCC1=NOC(c2cccc(OCC(=O)O)c2)C1 |
| InChI | InChI=1S/C14H18N2O5/c15-4-5-19-8-11-7-13(21-16-11)10-2-1-3-12(6-10)20-9-14(17)18/h1-3,6,13H,4-5,7-9,15H2,(H,17,18) |
| InChIKey | VTFPBGRLHSFBPT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|