About 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine
1-(2,4-difluorophenyl)-1,2-dihydrophthalazine (PubChem CID 23299794) has the molecular formula C14H10F2N2
and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine |
| PubChem CID | 23299794 |
| Molecular Formula | C14H10F2N2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine |
| SMILES | Fc1ccc(C2NN=Cc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C14H10F2N2/c15-10-5-6-12(13(16)7-10)14-11-4-2-1-3-9(11)8-17-18-14/h1-8,14,18H |
| InChIKey | GDYNCFOFEUNPOO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine?
The IUPAC name of 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine (CID 23299794) is 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine.
What is the SMILES notation for 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine?
The canonical SMILES for 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine is Fc1ccc(C2NN=Cc3ccccc32)c(F)c1.
What is the InChIKey of 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine?
The InChIKey is GDYNCFOFEUNPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2N2/c15-10-5-6-12(13(16)7-10)14-11-4-2-1-3-9(11)8-17-18-14/h1-8,14,18H.
What are the key properties of 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine?
1-(2,4-difluorophenyl)-1,2-dihydrophthalazine has a molecular weight of 244.24 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-1,2-dihydrophthalazine is sourced from PubChem (CID 23299794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).