C42H58N2O4 — CID 23300713
(E)-N-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3-octoxy-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide (PubChem CID 23300713) has the molecular formula C42H58N2O4 and a molecular weight of 654.94 g/mol. Its IUPAC name is (E)-N-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3-octoxy-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3-octoxy-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 23300713 |
| Molecular Formula | C42H58N2O4 |
| Molecular Weight | 654.94 g/mol |
| Exact Mass | 654.44 |
| IUPAC Name | (E)-N-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3-octoxy-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide |
| SMILES | CCCCCCCCOc1c(OC/C=C(\C)CCC=C(C)C)c2ccc(NC(=O)/C=C/c3ccccc3)cc2n(CCCCCC)c1=O |
| InChI | InChI=1S/C42H58N2O4/c1-6-8-10-12-13-18-30-47-41-40(48-31-28-34(5)21-19-20-33(3)4)37-26-25-36(43-39(45)27-24-35-22-15-14-16-23-35)32-38(37)44(42(41)46)29-17-11-9-7-2/h14-16,20,22-28,32H,6-13,17-19,21,29-31H2,1-5H3,(H,43,45)/b27-24+,34-28+ |
| InChIKey | OSEGTYWXVFABDS-UMXILRACSA-N |
| XLogP | 11.04 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.94 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|