C20H28N2O3 — CID 23301159
7-amino-4-(3-methylbut-2-enoxy)-3-(2-methylpentoxy)-1H-quinolin-2-one (PubChem CID 23301159) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 7-amino-4-(3-methylbut-2-enoxy)-3-(2-methylpentoxy)-1H-quinolin-2-one.
| Compound Name | 7-amino-4-(3-methylbut-2-enoxy)-3-(2-methylpentoxy)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 23301159 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 7-amino-4-(3-methylbut-2-enoxy)-3-(2-methylpentoxy)-1H-quinolin-2-one |
| SMILES | CCCC(C)COc1c(OCC=C(C)C)c2ccc(N)cc2[nH]c1=O |
| InChI | InChI=1S/C20H28N2O3/c1-5-6-14(4)12-25-19-18(24-10-9-13(2)3)16-8-7-15(21)11-17(16)22-20(19)23/h7-9,11,14H,5-6,10,12,21H2,1-4H3,(H,22,23) |
| InChIKey | NJJNHAWJDFNYRE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|