About 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid
3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid (PubChem CID 23301329) has the molecular formula C25H29NO4
and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid |
| PubChem CID | 23301329 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCN(CCC=C2c3ccccc3OCOc3ccccc32)CC1 |
| InChI | InChI=1S/C25H29NO4/c27-25(28)12-11-19-13-16-26(17-14-19)15-5-8-20-21-6-1-3-9-23(21)29-18-30-24-10-4-2-7-22(20)24/h1-4,6-10,19H,5,11-18H2,(H,27,28) |
| InChIKey | RXMQPKHDYDSCMQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid?
The IUPAC name of 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid (CID 23301329) is 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid.
What is the SMILES notation for 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid?
The canonical SMILES for 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid is O=C(O)CCC1CCN(CCC=C2c3ccccc3OCOc3ccccc32)CC1.
What is the InChIKey of 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid?
The InChIKey is RXMQPKHDYDSCMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO4/c27-25(28)12-11-19-13-16-26(17-14-19)15-5-8-20-21-6-1-3-9-23(21)29-18-30-24-10-4-2-7-22(20)24/h1-4,6-10,19H,5,11-18H2,(H,27,28).
What are the key properties of 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid?
3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid has a molecular weight of 407.51 g/mol, XLogP of 4.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]propanoic acid is sourced from PubChem (CID 23301329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).