About 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid
5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid (PubChem CID 23301330) has the molecular formula C27H33NO4
and a molecular weight of 435.56 g/mol. Its IUPAC name is 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid.
Molecular Properties
| Compound Name | 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid |
| PubChem CID | 23301330 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCCC1CCN(CCC=C2c3ccccc3OCOc3ccccc32)CC1 |
| InChI | InChI=1S/C27H33NO4/c29-27(30)14-6-1-8-21-15-18-28(19-16-21)17-7-11-22-23-9-2-4-12-25(23)31-20-32-26-13-5-3-10-24(22)26/h2-5,9-13,21H,1,6-8,14-20H2,(H,29,30) |
| InChIKey | CXWPMTCUQHFUBN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid?
The IUPAC name of 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid (CID 23301330) is 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid.
What is the SMILES notation for 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid?
The canonical SMILES for 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid is O=C(O)CCCCC1CCN(CCC=C2c3ccccc3OCOc3ccccc32)CC1.
What is the InChIKey of 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid?
The InChIKey is CXWPMTCUQHFUBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33NO4/c29-27(30)14-6-1-8-21-15-18-28(19-16-21)17-7-11-22-23-9-2-4-12-25(23)31-20-32-26-13-5-3-10-24(22)26/h2-5,9-13,21H,1,6-8,14-20H2,(H,29,30).
What are the key properties of 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid?
5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid has a molecular weight of 435.56 g/mol, XLogP of 5.59, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-4-yl]pentanoic acid is sourced from PubChem (CID 23301330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).