C22H19N — CID 23301367
3,5-diphenyl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene (PubChem CID 23301367) has the molecular formula C22H19N and a molecular weight of 297.40 g/mol. Its IUPAC name is 3,5-diphenyl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene.
| Compound Name | 3,5-diphenyl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene |
|---|---|
| PubChem CID | 23301367 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3,5-diphenyl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene |
| SMILES | C1=CC2CCC1c1c(-c3ccccc3)[nH]c(-c3ccccc3)c12 |
| InChI | InChI=1S/C22H19N/c1-3-7-17(8-4-1)21-19-15-11-13-16(14-12-15)20(19)22(23-21)18-9-5-2-6-10-18/h1-11,13,15-16,23H,12,14H2 |
| InChIKey | QYRYFRYBDCRFLV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|