About [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium
[amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium (PubChem CID 23301865) has the molecular formula C8H19N2O2S+
and a molecular weight of 207.32 g/mol. Its IUPAC name is [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium.
Molecular Properties
| Compound Name | [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium |
| PubChem CID | 23301865 |
| Molecular Formula | C8H19N2O2S+ |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium |
| SMILES | CCOC(C/[NH+]=C(/N)SC)OCC |
| InChI | InChI=1S/C8H18N2O2S/c1-4-11-7(12-5-2)6-10-8(9)13-3/h7H,4-6H2,1-3H3,(H2,9,10)/p+1 |
| InChIKey | XKEQEORFWSBJHY-UHFFFAOYSA-O |
| XLogP | -0.86 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium?
The IUPAC name of [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium (CID 23301865) is [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium.
What is the SMILES notation for [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium?
The canonical SMILES for [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium is CCOC(C/[NH+]=C(/N)SC)OCC.
What is the InChIKey of [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium?
The InChIKey is XKEQEORFWSBJHY-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H18N2O2S/c1-4-11-7(12-5-2)6-10-8(9)13-3/h7H,4-6H2,1-3H3,(H2,9,10)/p+1.
What are the key properties of [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium?
[amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium has a molecular weight of 207.32 g/mol, XLogP of -0.86, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium is sourced from PubChem (CID 23301865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).