About [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide
[amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide (PubChem CID 23301897) has the molecular formula C8H19IN2O2S
and a molecular weight of 334.22 g/mol. Its IUPAC name is [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide.
Molecular Properties
| Compound Name | [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide |
| PubChem CID | 23301897 |
| Molecular Formula | C8H19IN2O2S |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide |
| SMILES | CCOC(C/[NH+]=C(/N)SC)OCC.[I-] |
| InChI | InChI=1S/C8H18N2O2S.HI/c1-4-11-7(12-5-2)6-10-8(9)13-3;/h7H,4-6H2,1-3H3,(H2,9,10);1H |
| InChIKey | DOSUYWVGKBGTRU-UHFFFAOYSA-N |
| XLogP | -3.85 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide?
The IUPAC name of [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide (CID 23301897) is [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide.
What is the SMILES notation for [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide?
The canonical SMILES for [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide is CCOC(C/[NH+]=C(/N)SC)OCC.[I-].
What is the InChIKey of [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide?
The InChIKey is DOSUYWVGKBGTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2S.HI/c1-4-11-7(12-5-2)6-10-8(9)13-3;/h7H,4-6H2,1-3H3,(H2,9,10);1H.
What are the key properties of [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide?
[amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide has a molecular weight of 334.22 g/mol, XLogP of -3.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(methylsulfanyl)methylidene]-(2,2-diethoxyethyl)azanium iodide is sourced from PubChem (CID 23301897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).