About 3,4-diaminobenzene-1,2-dithiol;dihydrochloride
3,4-diaminobenzene-1,2-dithiol;dihydrochloride (PubChem CID 23302175) has the molecular formula C6H10Cl2N2S2
and a molecular weight of 245.20 g/mol. Its IUPAC name is 3,4-diaminobenzene-1,2-dithiol;dihydrochloride.
Molecular Properties
| Compound Name | 3,4-diaminobenzene-1,2-dithiol;dihydrochloride |
| PubChem CID | 23302175 |
| Molecular Formula | C6H10Cl2N2S2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 3,4-diaminobenzene-1,2-dithiol;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(S)c(S)c1N |
| InChI | InChI=1S/C6H8N2S2.2ClH/c7-3-1-2-4(9)6(10)5(3)8;;/h1-2,9-10H,7-8H2;2*1H |
| InChIKey | KNCBQULOEZHBNO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diaminobenzene-1,2-dithiol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminobenzene-1,2-dithiol;dihydrochloride?
The IUPAC name of 3,4-diaminobenzene-1,2-dithiol;dihydrochloride (CID 23302175) is 3,4-diaminobenzene-1,2-dithiol;dihydrochloride.
What is the SMILES notation for 3,4-diaminobenzene-1,2-dithiol;dihydrochloride?
The canonical SMILES for 3,4-diaminobenzene-1,2-dithiol;dihydrochloride is Cl.Cl.Nc1ccc(S)c(S)c1N.
What is the InChIKey of 3,4-diaminobenzene-1,2-dithiol;dihydrochloride?
The InChIKey is KNCBQULOEZHBNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S2.2ClH/c7-3-1-2-4(9)6(10)5(3)8;;/h1-2,9-10H,7-8H2;2*1H.
What are the key properties of 3,4-diaminobenzene-1,2-dithiol;dihydrochloride?
3,4-diaminobenzene-1,2-dithiol;dihydrochloride has a molecular weight of 245.20 g/mol, XLogP of 2.27, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminobenzene-1,2-dithiol;dihydrochloride is sourced from PubChem (CID 23302175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).