About N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide
N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide (PubChem CID 23303132) has the molecular formula C14H15Cl2NO4S
and a molecular weight of 364.25 g/mol. Its IUPAC name is N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide |
| PubChem CID | 23303132 |
| Molecular Formula | C14H15Cl2NO4S |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1c(C(=O)CC(=O)C2CC2)ccc(Cl)c1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C14H15Cl2NO4S/c1-17(22(2,20)21)14-9(5-6-10(15)13(14)16)12(19)7-11(18)8-3-4-8/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | CBFOELXQXWNINS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide (CID 23303132) is N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide is CN(c1c(C(=O)CC(=O)C2CC2)ccc(Cl)c1Cl)S(C)(=O)=O.
What is the InChIKey of N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide?
The InChIKey is CBFOELXQXWNINS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO4S/c1-17(22(2,20)21)14-9(5-6-10(15)13(14)16)12(19)7-11(18)8-3-4-8/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide?
N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide has a molecular weight of 364.25 g/mol, XLogP of 2.94, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-dichloro-6-(3-cyclopropyl-3-oxopropanoyl)phenyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 23303132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).