About 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol
2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol (PubChem CID 23303841) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol |
| PubChem CID | 23303841 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol |
| SMILES | OCCC1=C(C2=CCC=C2)CC=C1 |
| InChI | InChI=1S/C12H14O/c13-9-8-11-6-3-7-12(11)10-4-1-2-5-10/h1,3-6,13H,2,7-9H2 |
| InChIKey | GDHJPQCYNOYARI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol?
The IUPAC name of 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol (CID 23303841) is 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol.
What is the SMILES notation for 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol?
The canonical SMILES for 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol is OCCC1=C(C2=CCC=C2)CC=C1.
What is the InChIKey of 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol?
The InChIKey is GDHJPQCYNOYARI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O/c13-9-8-11-6-3-7-12(11)10-4-1-2-5-10/h1,3-6,13H,2,7-9H2.
What are the key properties of 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol?
2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol has a molecular weight of 174.24 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)ethanol is sourced from PubChem (CID 23303841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).