About 2,2,3-triacetyloxybutanoic acid
2,2,3-triacetyloxybutanoic acid (PubChem CID 23304116) has the molecular formula C10H14O8
and a molecular weight of 262.21 g/mol. Its IUPAC name is 2,2,3-triacetyloxybutanoic acid.
Molecular Properties
| Compound Name | 2,2,3-triacetyloxybutanoic acid |
| PubChem CID | 23304116 |
| Molecular Formula | C10H14O8 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2,2,3-triacetyloxybutanoic acid |
| SMILES | CC(=O)OC(C)C(OC(C)=O)(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H14O8/c1-5(16-6(2)11)10(9(14)15,17-7(3)12)18-8(4)13/h5H,1-4H3,(H,14,15) |
| InChIKey | VFVPGATWHMWCLC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2,3-triacetyloxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-triacetyloxybutanoic acid?
The IUPAC name of 2,2,3-triacetyloxybutanoic acid (CID 23304116) is 2,2,3-triacetyloxybutanoic acid.
What is the SMILES notation for 2,2,3-triacetyloxybutanoic acid?
The canonical SMILES for 2,2,3-triacetyloxybutanoic acid is CC(=O)OC(C)C(OC(C)=O)(OC(C)=O)C(=O)O.
What is the InChIKey of 2,2,3-triacetyloxybutanoic acid?
The InChIKey is VFVPGATWHMWCLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O8/c1-5(16-6(2)11)10(9(14)15,17-7(3)12)18-8(4)13/h5H,1-4H3,(H,14,15).
What are the key properties of 2,2,3-triacetyloxybutanoic acid?
2,2,3-triacetyloxybutanoic acid has a molecular weight of 262.21 g/mol, XLogP of -0.15, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-triacetyloxybutanoic acid is sourced from PubChem (CID 23304116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).