C17H30O12 — CID 23304501
[(2R,3S,4R,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-methylbutanoate (PubChem CID 23304501) has the molecular formula C17H30O12 and a molecular weight of 426.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 23304501 |
| Molecular Formula | C17H30O12 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC[C@H]1O[C@H](O[C@]2(CO)O[C@@H](CO)[C@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H30O12/c1-7(2)3-10(20)26-5-9-11(21)13(23)14(24)16(27-9)29-17(6-19)15(25)12(22)8(4-18)28-17/h7-9,11-16,18-19,21-25H,3-6H2,1-2H3/t8-,9+,11+,12-,13+,14+,15-,16+,17-/m0/s1 |
| InChIKey | VEILWHLPRZUKMJ-KBLFHPHSSA-N |
| XLogP | -3.80 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |