C22H30O13 — CID 23304635
[(2R,3S,4S,5R,6R)-6-[(2S,3S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 23304635) has the molecular formula C22H30O13 and a molecular weight of 502.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(2S,3S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(2S,3S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 23304635 |
| Molecular Formula | C22H30O13 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2S,3S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C22H30O13/c1-31-12-5-2-11(3-6-12)4-7-15(25)32-9-14-16(26)18(28)19(29)21(33-14)35-22(10-24)20(30)17(27)13(8-23)34-22/h2-7,13-14,16-21,23-24,26-30H,8-10H2,1H3/b7-4+/t13-,14-,16-,17+,18+,19-,20+,21-,22+/m1/s1 |
| InChIKey | OXZQUECTKHRQJG-RJZZIJQHSA-N |
| XLogP | -3.12 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|